C32H37N4O6+ — CID 70260099
[2-[[3-(carboxymethyl)phenyl]carbamoylamino]acetyl]-cyclopentyl-methyl-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]azanium (PubChem CID 70260099) has the molecular formula C32H37N4O6+ and a molecular weight of 573.67 g/mol. Its IUPAC name is [2-[[3-(carboxymethyl)phenyl]carbamoylamino]acetyl]-cyclopentyl-methyl-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]azanium.
| Compound Name | [2-[[3-(carboxymethyl)phenyl]carbamoylamino]acetyl]-cyclopentyl-methyl-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]azanium |
|---|---|
| PubChem CID | 70260099 |
| Molecular Formula | C32H37N4O6+ |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | [2-[[3-(carboxymethyl)phenyl]carbamoylamino]acetyl]-cyclopentyl-methyl-[2-[2-(N-methylanilino)-2-oxoethoxy]phenyl]azanium |
| SMILES | CN(C(=O)COc1ccccc1[N+](C)(C(=O)CNC(=O)Nc1cccc(CC(=O)O)c1)C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C32H36N4O6/c1-35(25-13-4-3-5-14-25)29(37)22-42-28-18-9-8-17-27(28)36(2,26-15-6-7-16-26)30(38)21-33-32(41)34-24-12-10-11-23(19-24)20-31(39)40/h3-5,8-14,17-19,26H,6-7,15-16,20-22H2,1-2H3,(H2-,33,34,39,40,41)/p+1 |
| InChIKey | JZXBVQVXPCKBGC-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|