C34H40N4O6 — CID 70260612
3-[[2-[cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azaniumyl]-2-oxoethyl]carbamoylamino]benzoate (PubChem CID 70260612) has the molecular formula C34H40N4O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is 3-[[2-[cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azaniumyl]-2-oxoethyl]carbamoylamino]benzoate.
| Compound Name | 3-[[2-[cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azaniumyl]-2-oxoethyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 70260612 |
| Molecular Formula | C34H40N4O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 3-[[2-[cyclohexyl-methyl-[2-[2-oxo-2-(N,3,5-trimethylanilino)ethoxy]phenyl]azaniumyl]-2-oxoethyl]carbamoylamino]benzoate |
| SMILES | Cc1cc(C)cc(N(C)C(=O)COc2ccccc2[N+](C)(C(=O)CNC(=O)Nc2cccc(C(=O)[O-])c2)C2CCCCC2)c1 |
| InChI | InChI=1S/C34H40N4O6/c1-23-17-24(2)19-27(18-23)37(3)31(39)22-44-30-16-9-8-15-29(30)38(4,28-13-6-5-7-14-28)32(40)21-35-34(43)36-26-12-10-11-25(20-26)33(41)42/h8-12,15-20,28H,5-7,13-14,21-22H2,1-4H3,(H2-,35,36,41,42,43) |
| InChIKey | YOWTZLPCIAHXMB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|