C33H47N3O6 — CID 70260455
methyl (8E,14S,17S)-4,4,19,19-tetramethyl-2,16-dioxo-3-(phenylmethoxycarbonylamino)-1,15-diazatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate (PubChem CID 70260455) has the molecular formula C33H47N3O6 and a molecular weight of 581.75 g/mol. Its IUPAC name is methyl (8E,14S,17S)-4,4,19,19-tetramethyl-2,16-dioxo-3-(phenylmethoxycarbonylamino)-1,15-diazatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate.
| Compound Name | methyl (8E,14S,17S)-4,4,19,19-tetramethyl-2,16-dioxo-3-(phenylmethoxycarbonylamino)-1,15-diazatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate |
|---|---|
| PubChem CID | 70260455 |
| Molecular Formula | C33H47N3O6 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | methyl (8E,14S,17S)-4,4,19,19-tetramethyl-2,16-dioxo-3-(phenylmethoxycarbonylamino)-1,15-diazatricyclo[15.4.0.018,20]henicos-8-ene-14-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCC/C=C/CCCC(C)(C)C(NC(=O)OCc2ccccc2)C(=O)N2CC3C([C@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C33H47N3O6/c1-32(2)19-15-10-8-6-7-9-14-18-24(30(39)41-5)34-28(37)26-25-23(33(25,3)4)20-36(26)29(38)27(32)35-31(40)42-21-22-16-12-11-13-17-22/h6,8,11-13,16-17,23-27H,7,9-10,14-15,18-21H2,1-5H3,(H,34,37)(H,35,40)/b8-6+/t23?,24-,25?,26-,27?/m0/s1 |
| InChIKey | QVSKYJYKPJFIHO-LVUXVULJSA-N |
| XLogP | 4.75 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|