C14H22ClN — CID 70262030
4-(4-chlorocyclohexa-1,3-dien-1-yl)-4-propylpiperidine (PubChem CID 70262030) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 4-(4-chlorocyclohexa-1,3-dien-1-yl)-4-propylpiperidine.
| Compound Name | 4-(4-chlorocyclohexa-1,3-dien-1-yl)-4-propylpiperidine |
|---|---|
| PubChem CID | 70262030 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-(4-chlorocyclohexa-1,3-dien-1-yl)-4-propylpiperidine |
| SMILES | CCCC1(C2=CC=C(Cl)CC2)CCNCC1 |
| InChI | InChI=1S/C14H22ClN/c1-2-7-14(8-10-16-11-9-14)12-3-5-13(15)6-4-12/h3,5,16H,2,4,6-11H2,1H3 |
| InChIKey | BOIYGKCKCJNCJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |