C12H19Cl2N — CID 89297611
(3S)-3-[(2E,4Z)-4,5-dichlorohexa-2,4-dien-2-yl]-3-methylpiperidine (PubChem CID 89297611) has the molecular formula C12H19Cl2N and a molecular weight of 248.20 g/mol. Its IUPAC name is (3S)-3-[(2E,4Z)-4,5-dichlorohexa-2,4-dien-2-yl]-3-methylpiperidine.
| Compound Name | (3S)-3-[(2E,4Z)-4,5-dichlorohexa-2,4-dien-2-yl]-3-methylpiperidine |
|---|---|
| PubChem CID | 89297611 |
| Molecular Formula | C12H19Cl2N |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (3S)-3-[(2E,4Z)-4,5-dichlorohexa-2,4-dien-2-yl]-3-methylpiperidine |
| SMILES | C/C(Cl)=C(Cl)\C=C(/C)[C@]1(C)CCCNC1 |
| InChI | InChI=1S/C12H19Cl2N/c1-9(7-11(14)10(2)13)12(3)5-4-6-15-8-12/h7,15H,4-6,8H2,1-3H3/b9-7+,11-10-/t12-/m1/s1 |
| InChIKey | DRZQCWZZNRQTHT-KPNAFSNISA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|