C15H19NO5S — CID 70264148
ethyl 2-[(4-acetylphenyl)sulfonylamino]pent-4-enoate (PubChem CID 70264148) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is ethyl 2-[(4-acetylphenyl)sulfonylamino]pent-4-enoate.
| Compound Name | ethyl 2-[(4-acetylphenyl)sulfonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 70264148 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | ethyl 2-[(4-acetylphenyl)sulfonylamino]pent-4-enoate |
| SMILES | C=CCC(NS(=O)(=O)c1ccc(C(C)=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C15H19NO5S/c1-4-6-14(15(18)21-5-2)16-22(19,20)13-9-7-12(8-10-13)11(3)17/h4,7-10,14,16H,1,5-6H2,2-3H3 |
| InChIKey | HDUZBKTVOUEMAM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|