C15H21NO5S — CID 59280295
ethyl (2S)-2-[[4-[(1S)-1-hydroxyethyl]phenyl]sulfonylamino]pent-4-enoate (PubChem CID 59280295) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is ethyl (2S)-2-[[4-[(1S)-1-hydroxyethyl]phenyl]sulfonylamino]pent-4-enoate.
| Compound Name | ethyl (2S)-2-[[4-[(1S)-1-hydroxyethyl]phenyl]sulfonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 59280295 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | ethyl (2S)-2-[[4-[(1S)-1-hydroxyethyl]phenyl]sulfonylamino]pent-4-enoate |
| SMILES | C=CC[C@H](NS(=O)(=O)c1ccc([C@H](C)O)cc1)C(=O)OCC |
| InChI | InChI=1S/C15H21NO5S/c1-4-6-14(15(18)21-5-2)16-22(19,20)13-9-7-12(8-10-13)11(3)17/h4,7-11,14,16-17H,1,5-6H2,2-3H3/t11-,14-/m0/s1 |
| InChIKey | BVDAHZLRGFJTLD-FZMZJTMJSA-N |
| XLogP | 1.53 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|