C12H20N2 — CID 70264180
1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine (PubChem CID 70264180) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 70264180 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine |
| SMILES | CN1CCN(CC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C12H20N2/c1-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12/h3,5-6H,2,4,7-11H2,1H3 |
| InChIKey | SNORSPBPXBRJDZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |