C17H30N2O4S — CID 70267122
N-[(2S)-6-amino-1-hydroxyheptan-2-yl]-4-(hydroxymethyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 70267122) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-hydroxyheptan-2-yl]-4-(hydroxymethyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[(2S)-6-amino-1-hydroxyheptan-2-yl]-4-(hydroxymethyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 70267122 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[(2S)-6-amino-1-hydroxyheptan-2-yl]-4-(hydroxymethyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(N)CCC[C@@H](CO)N(C(C)C)S(=O)(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C17H30N2O4S/c1-13(2)19(16(12-21)6-4-5-14(3)18)24(22,23)17-9-7-15(11-20)8-10-17/h7-10,13-14,16,20-21H,4-6,11-12,18H2,1-3H3/t14?,16-/m0/s1 |
| InChIKey | XIXTYKANPXDJFB-WMCAAGNKSA-N |
| XLogP | 1.46 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |