C16H22N4O3 — CID 70270187
ethyl 3-[(benzylamino)carbamoyl]-2-ethyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 70270187) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is ethyl 3-[(benzylamino)carbamoyl]-2-ethyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 3-[(benzylamino)carbamoyl]-2-ethyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 70270187 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | ethyl 3-[(benzylamino)carbamoyl]-2-ethyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(CC)C(C(=O)NNCc2ccccc2)C1 |
| InChI | InChI=1S/C16H22N4O3/c1-3-20-14(10-13(19-20)16(22)23-4-2)15(21)18-17-11-12-8-6-5-7-9-12/h5-9,14,17H,3-4,10-11H2,1-2H3,(H,18,21) |
| InChIKey | QBOVQWNDSXXXEH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|