C17H24N2O2 — CID 10957167
ethyl 2-benzyl-3-butyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 10957167) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is ethyl 2-benzyl-3-butyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 2-benzyl-3-butyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 10957167 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ethyl 2-benzyl-3-butyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCCCC1CC(C(=O)OCC)=NN1Cc1ccccc1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-5-11-15-12-16(17(20)21-4-2)18-19(15)13-14-9-7-6-8-10-14/h6-10,15H,3-5,11-13H2,1-2H3 |
| InChIKey | CPCJAZBXVXERPH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |