C14H15N3O2 — CID 134871021
ethyl 2-benzyl-3-cyano-3,4-dihydropyrazole-5-carboxylate (PubChem CID 134871021) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 2-benzyl-3-cyano-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 2-benzyl-3-cyano-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 134871021 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | ethyl 2-benzyl-3-cyano-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(Cc2ccccc2)C(C#N)C1 |
| InChI | InChI=1S/C14H15N3O2/c1-2-19-14(18)13-8-12(9-15)17(16-13)10-11-6-4-3-5-7-11/h3-7,12H,2,8,10H2,1H3 |
| InChIKey | QGJGLAZCHCQZIM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |