C25H30ClF3N2O — CID 70271975
2-chloro-N-[2-[2-methylbutyl(prop-2-enyl)amino]-1-phenylpropyl]-3-(trifluoromethyl)benzamide (PubChem CID 70271975) has the molecular formula C25H30ClF3N2O and a molecular weight of 466.98 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-methylbutyl(prop-2-enyl)amino]-1-phenylpropyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[2-[2-methylbutyl(prop-2-enyl)amino]-1-phenylpropyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 70271975 |
| Molecular Formula | C25H30ClF3N2O |
| Molecular Weight | 466.98 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-chloro-N-[2-[2-methylbutyl(prop-2-enyl)amino]-1-phenylpropyl]-3-(trifluoromethyl)benzamide |
| SMILES | C=CCN(CC(C)CC)C(C)C(NC(=O)c1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C25H30ClF3N2O/c1-5-15-31(16-17(3)6-2)18(4)23(19-11-8-7-9-12-19)30-24(32)20-13-10-14-21(22(20)26)25(27,28)29/h5,7-14,17-18,23H,1,6,15-16H2,2-4H3,(H,30,32) |
| InChIKey | FNOOCOBWPLUIIK-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.98 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|