C19H20ClF3N6O — CID 129152914
N-[(3Z)-3-amino-4-[amino(pyrimidin-2-yl)amino]hepta-3,6-dien-2-yl]-2-chloro-3-(trifluoromethyl)benzamide (PubChem CID 129152914) has the molecular formula C19H20ClF3N6O and a molecular weight of 440.86 g/mol. Its IUPAC name is N-[(3Z)-3-amino-4-[amino(pyrimidin-2-yl)amino]hepta-3,6-dien-2-yl]-2-chloro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(3Z)-3-amino-4-[amino(pyrimidin-2-yl)amino]hepta-3,6-dien-2-yl]-2-chloro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129152914 |
| Molecular Formula | C19H20ClF3N6O |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[(3Z)-3-amino-4-[amino(pyrimidin-2-yl)amino]hepta-3,6-dien-2-yl]-2-chloro-3-(trifluoromethyl)benzamide |
| SMILES | C=CC/C(=C(/N)C(C)NC(=O)c1cccc(C(F)(F)F)c1Cl)N(N)c1ncccn1 |
| InChI | InChI=1S/C19H20ClF3N6O/c1-3-6-14(29(25)18-26-9-5-10-27-18)16(24)11(2)28-17(30)12-7-4-8-13(15(12)20)19(21,22)23/h3-5,7-11H,1,6,24-25H2,2H3,(H,28,30)/b16-14- |
| InChIKey | DWTLSVLSNHSLED-PEZBUJJGSA-N |
| XLogP | 3.39 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|