C23H23N3O — CID 70274027
4-(1-benzylpiperidin-4-yl)oxy-2-methylquinoline-6-carbonitrile (PubChem CID 70274027) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)oxy-2-methylquinoline-6-carbonitrile.
| Compound Name | 4-(1-benzylpiperidin-4-yl)oxy-2-methylquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 70274027 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)oxy-2-methylquinoline-6-carbonitrile |
| SMILES | Cc1cc(OC2CCN(Cc3ccccc3)CC2)c2cc(C#N)ccc2n1 |
| InChI | InChI=1S/C23H23N3O/c1-17-13-23(21-14-19(15-24)7-8-22(21)25-17)27-20-9-11-26(12-10-20)16-18-5-3-2-4-6-18/h2-8,13-14,20H,9-12,16H2,1H3 |
| InChIKey | LIBFQTLPDIBDOX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |