C26H32N2O — CID 7027596
N-[(2S)-2-ethylhexyl]-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 7027596) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is N-[(2S)-2-ethylhexyl]-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(2S)-2-ethylhexyl]-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 7027596 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[(2S)-2-ethylhexyl]-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | CCCC[C@H](CC)CNC(=O)c1c(C)c(-c2ccc(C)cc2)nc2ccccc12 |
| InChI | InChI=1S/C26H32N2O/c1-5-7-10-20(6-2)17-27-26(29)24-19(4)25(21-15-13-18(3)14-16-21)28-23-12-9-8-11-22(23)24/h8-9,11-16,20H,5-7,10,17H2,1-4H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | QNQACJBCKNZFOM-FQEVSTJZSA-N |
| XLogP | 6.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |