C8H8N2 — CID 70279780
2,8-dihydro-2,6-naphthyridine (PubChem CID 70279780) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 2,8-dihydro-2,6-naphthyridine.
| Compound Name | 2,8-dihydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 70279780 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2,8-dihydro-2,6-naphthyridine |
| SMILES | C1=CC2=CN=CCC2=CN1 |
| InChI | InChI=1S/C8H8N2/c1-3-9-6-8-2-4-10-5-7(1)8/h1,3-6,9H,2H2 |
| InChIKey | MGTRGUKEMGDAPA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |