C9H11N3 — CID 91420020
2-(1,4-dihydropyridin-3-yl)-2,5-dihydropyrimidine (PubChem CID 91420020) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 2-(1,4-dihydropyridin-3-yl)-2,5-dihydropyrimidine.
| Compound Name | 2-(1,4-dihydropyridin-3-yl)-2,5-dihydropyrimidine |
|---|---|
| PubChem CID | 91420020 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-(1,4-dihydropyridin-3-yl)-2,5-dihydropyrimidine |
| SMILES | C1=CNC=C(C2N=CCC=N2)C1 |
| InChI | InChI=1S/C9H11N3/c1-3-8(7-10-4-1)9-11-5-2-6-12-9/h1,4-7,9-10H,2-3H2 |
| InChIKey | RIRKTNBLPHHDHG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |