C15H20N2O3 — CID 70290027
(2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 70290027) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70290027 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | NN1C[C@H](C(=O)CCCc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C15H20N2O3/c16-17-10-12(9-13(17)15(19)20)14(18)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10,16H2,(H,19,20)/t12-,13+/m1/s1 |
| InChIKey | FMTBSHHZZSJKNX-OLZOCXBDSA-N |
| XLogP | 1.23 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|