C24H31N3O3 — CID 70290026
(2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid;2,3-dihydro-1H-inden-5-amine (PubChem CID 70290026) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid;2,3-dihydro-1H-inden-5-amine.
| Compound Name | (2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid;2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 70290026 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (2S,4R)-1-amino-4-(4-phenylbutanoyl)pyrrolidine-2-carboxylic acid;2,3-dihydro-1H-inden-5-amine |
| SMILES | NN1C[C@H](C(=O)CCCc2ccccc2)C[C@H]1C(=O)O.Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H20N2O3.C9H11N/c16-17-10-12(9-13(17)15(19)20)14(18)8-4-7-11-5-2-1-3-6-11;10-9-5-4-7-2-1-3-8(7)6-9/h1-3,5-6,12-13H,4,7-10,16H2,(H,19,20);4-6H,1-3,10H2/t12-,13+;/m1./s1 |
| InChIKey | JBFKVVVQYHTELS-KZCZEQIWSA-N |
| XLogP | 2.98 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|