C18H28O13 — CID 70290152
[(2R,3R,4S,5S,6R)-2-[(2S,3S,4R,5R)-3-acetyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2-methylprop-2-enoate (PubChem CID 70290152) has the molecular formula C18H28O13 and a molecular weight of 452.41 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-[(2S,3S,4R,5R)-3-acetyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2-methylprop-2-enoate.
| Compound Name | [(2R,3R,4S,5S,6R)-2-[(2S,3S,4R,5R)-3-acetyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70290152 |
| Molecular Formula | C18H28O13 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-[(2S,3S,4R,5R)-3-acetyloxy-4-hydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2OC(C)=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H28O13/c1-7(2)16(26)29-14-13(25)11(23)9(4-19)28-17(14)31-18(6-21)15(27-8(3)22)12(24)10(5-20)30-18/h9-15,17,19-21,23-25H,1,4-6H2,2-3H3/t9-,10-,11-,12-,13+,14-,15+,17-,18+/m1/s1 |
| InChIKey | MCEWAFWYCUTAGN-BUDFFRDRSA-N |
| XLogP | -3.70 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|