C11H10N2O — CID 70291895
3-[(Z)-prop-1-enyl]-7H-1,7-naphthyridin-8-one (PubChem CID 70291895) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-[(Z)-prop-1-enyl]-7H-1,7-naphthyridin-8-one.
| Compound Name | 3-[(Z)-prop-1-enyl]-7H-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 70291895 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-[(Z)-prop-1-enyl]-7H-1,7-naphthyridin-8-one |
| SMILES | C/C=C\c1cnc2c(=O)[nH]ccc2c1 |
| InChI | InChI=1S/C11H10N2O/c1-2-3-8-6-9-4-5-12-11(14)10(9)13-7-8/h2-7H,1H3,(H,12,14)/b3-2- |
| InChIKey | PIGCYCLSFFLBED-IHWYPQMZSA-N |
| XLogP | 1.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |