C19H16ClN3OS — CID 7029271
(5R)-3-(4-chloro-3-methylphenyl)-5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 7029271) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is (5R)-3-(4-chloro-3-methylphenyl)-5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5R)-3-(4-chloro-3-methylphenyl)-5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 7029271 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (5R)-3-(4-chloro-3-methylphenyl)-5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1cc(N2C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC2=S)ccc1Cl |
| InChI | InChI=1S/C19H16ClN3OS/c1-11-8-13(6-7-15(11)20)23-18(24)17(22-19(23)25)9-12-10-21-16-5-3-2-4-14(12)16/h2-8,10,17,21H,9H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | PBHLIYMUWBBELZ-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|