C18H20FIN4O — CID 70295598
N-(4-aminocyclohexyl)-5-fluoro-2-(3-iodoanilino)pyridine-3-carboxamide (PubChem CID 70295598) has the molecular formula C18H20FIN4O and a molecular weight of 454.29 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-fluoro-2-(3-iodoanilino)pyridine-3-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-5-fluoro-2-(3-iodoanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70295598 |
| Molecular Formula | C18H20FIN4O |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-fluoro-2-(3-iodoanilino)pyridine-3-carboxamide |
| SMILES | NC1CCC(NC(=O)c2cc(F)cnc2Nc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C18H20FIN4O/c19-11-8-16(18(25)24-14-6-4-13(21)5-7-14)17(22-10-11)23-15-3-1-2-12(20)9-15/h1-3,8-10,13-14H,4-7,21H2,(H,22,23)(H,24,25) |
| InChIKey | QRPALAXWMZZZRD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|