C21H26N2O6 — CID 70296386
tert-butyl N-[2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enyl]-1,3-dioxoisoindol-4-yl]carbamate (PubChem CID 70296386) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is tert-butyl N-[2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enyl]-1,3-dioxoisoindol-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enyl]-1,3-dioxoisoindol-4-yl]carbamate |
|---|---|
| PubChem CID | 70296386 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | tert-butyl N-[2-[(E)-5-(1,3-dioxolan-2-yl)pent-2-enyl]-1,3-dioxoisoindol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc2c1C(=O)N(C/C=C/CCC1OCCO1)C2=O |
| InChI | InChI=1S/C21H26N2O6/c1-21(2,3)29-20(26)22-15-9-7-8-14-17(15)19(25)23(18(14)24)11-6-4-5-10-16-27-12-13-28-16/h4,6-9,16H,5,10-13H2,1-3H3,(H,22,26)/b6-4+ |
| InChIKey | USQXZTYWFCQURZ-GQCTYLIASA-N |
| XLogP | 3.34 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|