C44H42N8 — CID 70298023
10,12,13,23-tetrakis(1-methyl-2H-pyridin-3-yl)-21H-porphyrin (PubChem CID 70298023) has the molecular formula C44H42N8 and a molecular weight of 682.88 g/mol. Its IUPAC name is 10,12,13,23-tetrakis(1-methyl-2H-pyridin-3-yl)-21H-porphyrin.
| Compound Name | 10,12,13,23-tetrakis(1-methyl-2H-pyridin-3-yl)-21H-porphyrin |
|---|---|
| PubChem CID | 70298023 |
| Molecular Formula | C44H42N8 |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 10,12,13,23-tetrakis(1-methyl-2H-pyridin-3-yl)-21H-porphyrin |
| SMILES | CN1C=CC=C(c2c(C3=CC=CN(C)C3)c3c(C4=CC=CN(C)C4)c4nc(cc5ccc(cc6nc(cc2n3C2=CC=CN(C)C2)C=C6)[nH]5)C=C4)C1 |
| InChI | InChI=1S/C44H42N8/c1-48-19-5-9-30(26-48)41-39-18-17-36(47-39)24-35-14-13-33(45-35)23-34-15-16-37(46-34)25-40-42(31-10-6-20-49(2)27-31)43(32-11-7-21-50(3)28-32)44(41)52(40)38-12-8-22-51(4)29-38/h5-25,45H,26-29H2,1-4H3/b33-23-,34-23-,35-24-,36-24-,37-25-,40-25-,41-39-,44-41- |
| InChIKey | PHHKUQHAEBBNRM-KZUUJKLDSA-N |
| XLogP | 7.96 |
| TPSA | 59.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |