C10H13FN2 — CID 70300942
2-(5-fluoro-3a,7a-dihydro-1H-indol-3-yl)ethanamine (PubChem CID 70300942) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-(5-fluoro-3a,7a-dihydro-1H-indol-3-yl)ethanamine.
| Compound Name | 2-(5-fluoro-3a,7a-dihydro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 70300942 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 2-(5-fluoro-3a,7a-dihydro-1H-indol-3-yl)ethanamine |
| SMILES | NCCC1=CNC2C=CC(F)=CC12 |
| InChI | InChI=1S/C10H13FN2/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10/h1-2,5-6,9-10,13H,3-4,12H2 |
| InChIKey | HGKYKXPNEGZRSK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |