About 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole
3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole (PubChem CID 59950841) has the molecular formula C10H12FN
and a molecular weight of 165.21 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole |
| PubChem CID | 59950841 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole |
| SMILES | CCC1=CNC2C=CC(F)=CC12 |
| InChI | InChI=1S/C10H12FN/c1-2-7-6-12-10-4-3-8(11)5-9(7)10/h3-6,9-10,12H,2H2,1H3 |
| InChIKey | WYNNYTPJIRBWHQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole?
The IUPAC name of 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole (CID 59950841) is 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole.
What is the SMILES notation for 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole?
The canonical SMILES for 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole is CCC1=CNC2C=CC(F)=CC12.
What is the InChIKey of 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole?
The InChIKey is WYNNYTPJIRBWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN/c1-2-7-6-12-10-4-3-8(11)5-9(7)10/h3-6,9-10,12H,2H2,1H3.
What are the key properties of 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole?
3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole has a molecular weight of 165.21 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole is sourced from PubChem (CID 59950841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).