C10H12FN — CID 59950841
3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole (PubChem CID 59950841) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole.
| Compound Name | 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole |
|---|---|
| PubChem CID | 59950841 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 3-ethyl-5-fluoro-3a,7a-dihydro-1H-indole |
| SMILES | CCC1=CNC2C=CC(F)=CC12 |
| InChI | InChI=1S/C10H12FN/c1-2-7-6-12-10-4-3-8(11)5-9(7)10/h3-6,9-10,12H,2H2,1H3 |
| InChIKey | WYNNYTPJIRBWHQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |