C16H18O3 — CID 70301232
2-ethyl-2-methyl-3,4,6a,7-tetrahydrobenzo[h]chromene-5,6-dione (PubChem CID 70301232) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-ethyl-2-methyl-3,4,6a,7-tetrahydrobenzo[h]chromene-5,6-dione.
| Compound Name | 2-ethyl-2-methyl-3,4,6a,7-tetrahydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 70301232 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-ethyl-2-methyl-3,4,6a,7-tetrahydrobenzo[h]chromene-5,6-dione |
| SMILES | CCC1(C)CCC2=C(O1)C1=CC=CCC1C(=O)C2=O |
| InChI | InChI=1S/C16H18O3/c1-3-16(2)9-8-12-14(18)13(17)10-6-4-5-7-11(10)15(12)19-16/h4-5,7,10H,3,6,8-9H2,1-2H3 |
| InChIKey | OJHXWPJPLOJOGH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|