C24H36O3 — CID 162667232
(7R,8aR,9R,10aR)-2,2,4,4,10a-pentamethyl-7,9-di(propan-2-yl)-7,8,8a,9-tetrahydroxanthene-1,3-dione (PubChem CID 162667232) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (7R,8aR,9R,10aR)-2,2,4,4,10a-pentamethyl-7,9-di(propan-2-yl)-7,8,8a,9-tetrahydroxanthene-1,3-dione.
| Compound Name | (7R,8aR,9R,10aR)-2,2,4,4,10a-pentamethyl-7,9-di(propan-2-yl)-7,8,8a,9-tetrahydroxanthene-1,3-dione |
|---|---|
| PubChem CID | 162667232 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (7R,8aR,9R,10aR)-2,2,4,4,10a-pentamethyl-7,9-di(propan-2-yl)-7,8,8a,9-tetrahydroxanthene-1,3-dione |
| SMILES | CC(C)[C@@H]1C=C[C@@]2(C)OC3=C(C(=O)C(C)(C)C(=O)C3(C)C)[C@H](C(C)C)[C@H]2C1 |
| InChI | InChI=1S/C24H36O3/c1-13(2)15-10-11-24(9)16(12-15)17(14(3)4)18-19(25)22(5,6)21(26)23(7,8)20(18)27-24/h10-11,13-17H,12H2,1-9H3/t15-,16-,17-,24-/m1/s1 |
| InChIKey | CSYLCVIIBKDWLG-FBPDVEOQSA-N |
| XLogP | 5.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|