C28H30N2 — CID 70303221
2,2-diphenyl-2-[(1S,3R)-3-(2-phenylethylamino)cyclohexyl]acetonitrile (PubChem CID 70303221) has the molecular formula C28H30N2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2,2-diphenyl-2-[(1S,3R)-3-(2-phenylethylamino)cyclohexyl]acetonitrile.
| Compound Name | 2,2-diphenyl-2-[(1S,3R)-3-(2-phenylethylamino)cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 70303221 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2,2-diphenyl-2-[(1S,3R)-3-(2-phenylethylamino)cyclohexyl]acetonitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)[C@H]1CCC[C@@H](NCCc2ccccc2)C1 |
| InChI | InChI=1S/C28H30N2/c29-22-28(24-13-6-2-7-14-24,25-15-8-3-9-16-25)26-17-10-18-27(21-26)30-20-19-23-11-4-1-5-12-23/h1-9,11-16,26-27,30H,10,17-21H2/t26-,27+/m0/s1 |
| InChIKey | DEPFMYXNVFOFLN-RRPNLBNLSA-N |
| XLogP | 5.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |