C26H29N3O — CID 70303251
2-[3-[methyl(pyridin-3-ylmethyl)amino]cyclopentyl]-2,2-diphenylacetamide (PubChem CID 70303251) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[3-[methyl(pyridin-3-ylmethyl)amino]cyclopentyl]-2,2-diphenylacetamide.
| Compound Name | 2-[3-[methyl(pyridin-3-ylmethyl)amino]cyclopentyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 70303251 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-[3-[methyl(pyridin-3-ylmethyl)amino]cyclopentyl]-2,2-diphenylacetamide |
| SMILES | CN(Cc1cccnc1)C1CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H29N3O/c1-29(19-20-9-8-16-28-18-20)24-15-14-23(17-24)26(25(27)30,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-13,16,18,23-24H,14-15,17,19H2,1H3,(H2,27,30) |
| InChIKey | INZDEPSGWMWUSE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |