C28H31N3O3 — CID 70302941
2-[3-[methyl-[2-(4-nitrophenyl)ethyl]amino]cyclopentyl]-2,2-diphenylacetamide (PubChem CID 70302941) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-[3-[methyl-[2-(4-nitrophenyl)ethyl]amino]cyclopentyl]-2,2-diphenylacetamide.
| Compound Name | 2-[3-[methyl-[2-(4-nitrophenyl)ethyl]amino]cyclopentyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 70302941 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 2-[3-[methyl-[2-(4-nitrophenyl)ethyl]amino]cyclopentyl]-2,2-diphenylacetamide |
| SMILES | CN(CCc1ccc([N+](=O)[O-])cc1)C1CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H31N3O3/c1-30(19-18-21-12-15-25(16-13-21)31(33)34)26-17-14-24(20-26)28(27(29)32,22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-13,15-16,24,26H,14,17-20H2,1H3,(H2,29,32) |
| InChIKey | QUABWEGNJZXFJX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|