C14H20N2O3 — CID 174414905
2,2-diethyl-4-(4-nitrophenyl)butanamide (PubChem CID 174414905) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2,2-diethyl-4-(4-nitrophenyl)butanamide.
| Compound Name | 2,2-diethyl-4-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 174414905 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2,2-diethyl-4-(4-nitrophenyl)butanamide |
| SMILES | CCC(CC)(CCc1ccc([N+](=O)[O-])cc1)C(N)=O |
| InChI | InChI=1S/C14H20N2O3/c1-3-14(4-2,13(15)17)10-9-11-5-7-12(8-6-11)16(18)19/h5-8H,3-4,9-10H2,1-2H3,(H2,15,17) |
| InChIKey | PYEXHXWFOBVIDK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|