C30H37N7O6Si — CID 70304124
4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-[[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methyl]tetrazol-2-yl]pentanoic acid (PubChem CID 70304124) has the molecular formula C30H37N7O6Si and a molecular weight of 619.76 g/mol. Its IUPAC name is 4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-[[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methyl]tetrazol-2-yl]pentanoic acid.
| Compound Name | 4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-[[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methyl]tetrazol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 70304124 |
| Molecular Formula | C30H37N7O6Si |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-[[3-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]phenyl]methyl]tetrazol-2-yl]pentanoic acid |
| SMILES | C[Si](C)(C)CCOCn1ccnc1-c1cccc(Cc2nnn(CC(=O)C(CC(=O)O)NC(=O)OCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C30H37N7O6Si/c1-44(2,3)15-14-42-21-36-13-12-31-29(36)24-11-7-10-23(16-24)17-27-33-35-37(34-27)19-26(38)25(18-28(39)40)32-30(41)43-20-22-8-5-4-6-9-22/h4-13,16,25H,14-15,17-21H2,1-3H3,(H,32,41)(H,39,40) |
| InChIKey | FGLPXBMKHTYLNV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|