C17H19N7O3S — CID 70306670
1-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-3-(1-methylpyrazol-3-yl)urea (PubChem CID 70306670) has the molecular formula C17H19N7O3S and a molecular weight of 401.45 g/mol. Its IUPAC name is 1-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-3-(1-methylpyrazol-3-yl)urea.
| Compound Name | 1-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-3-(1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 70306670 |
| Molecular Formula | C17H19N7O3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1-[4-[4-amino-6-(methylsulfonylmethyl)pyrimidin-2-yl]phenyl]-3-(1-methylpyrazol-3-yl)urea |
| SMILES | Cn1ccc(NC(=O)Nc2ccc(-c3nc(N)cc(CS(C)(=O)=O)n3)cc2)n1 |
| InChI | InChI=1S/C17H19N7O3S/c1-24-8-7-15(23-24)22-17(25)20-12-5-3-11(4-6-12)16-19-13(9-14(18)21-16)10-28(2,26)27/h3-9H,10H2,1-2H3,(H2,18,19,21)(H2,20,22,23,25) |
| InChIKey | PBEDALPNDHIOHV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |