C14H14N4O3 — CID 61205448
3-[4-[(1-methylpyrazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid (PubChem CID 61205448) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-[4-[(1-methylpyrazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(1-methylpyrazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 61205448 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-[4-[(1-methylpyrazol-3-yl)carbamoylamino]phenyl]prop-2-enoic acid |
| SMILES | Cn1ccc(NC(=O)Nc2ccc(C=CC(=O)O)cc2)n1 |
| InChI | InChI=1S/C14H14N4O3/c1-18-9-8-12(17-18)16-14(21)15-11-5-2-10(3-6-11)4-7-13(19)20/h2-9H,1H3,(H,19,20)(H2,15,16,17,21) |
| InChIKey | ARFKTURTVKSTKO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|