C12H10N4O3S — CID 114913075
(E)-3-[4-(thiadiazol-5-ylcarbamoylamino)phenyl]prop-2-enoic acid (PubChem CID 114913075) has the molecular formula C12H10N4O3S and a molecular weight of 290.30 g/mol. Its IUPAC name is (E)-3-[4-(thiadiazol-5-ylcarbamoylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(thiadiazol-5-ylcarbamoylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114913075 |
| Molecular Formula | C12H10N4O3S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (E)-3-[4-(thiadiazol-5-ylcarbamoylamino)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)Nc2cnns2)cc1 |
| InChI | InChI=1S/C12H10N4O3S/c17-11(18)6-3-8-1-4-9(5-2-8)14-12(19)15-10-7-13-16-20-10/h1-7H,(H,17,18)(H2,14,15,19)/b6-3+ |
| InChIKey | BGMXGTQWLUBOAB-ZZXKWVIFSA-N |
| XLogP | 2.28 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|