C16H20N6O4S2 — CID 88855589
1-[4-[4-(carbamothioylsulfonylmethyl)-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylurea (PubChem CID 88855589) has the molecular formula C16H20N6O4S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-[4-[4-(carbamothioylsulfonylmethyl)-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylurea.
| Compound Name | 1-[4-[4-(carbamothioylsulfonylmethyl)-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 88855589 |
| Molecular Formula | C16H20N6O4S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 1-[4-[4-(carbamothioylsulfonylmethyl)-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(-c2nc(CS(=O)(=O)C(N)=S)cc(NCCO)n2)cc1 |
| InChI | InChI=1S/C16H20N6O4S2/c1-18-16(24)21-11-4-2-10(3-5-11)14-20-12(9-28(25,26)15(17)27)8-13(22-14)19-6-7-23/h2-5,8,23H,6-7,9H2,1H3,(H2,17,27)(H2,18,21,24)(H,19,20,22) |
| InChIKey | VISCLFFLZQVHLQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 159.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|