C23H27N5O3S2 — CID 87287407
1-[4-[4-[2-(benzenesulfonyl)propan-2-yl]-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylthiourea (PubChem CID 87287407) has the molecular formula C23H27N5O3S2 and a molecular weight of 485.64 g/mol. Its IUPAC name is 1-[4-[4-[2-(benzenesulfonyl)propan-2-yl]-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylthiourea.
| Compound Name | 1-[4-[4-[2-(benzenesulfonyl)propan-2-yl]-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 87287407 |
| Molecular Formula | C23H27N5O3S2 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 1-[4-[4-[2-(benzenesulfonyl)propan-2-yl]-6-(2-hydroxyethylamino)pyrimidin-2-yl]phenyl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccc(-c2nc(NCCO)cc(C(C)(C)S(=O)(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H27N5O3S2/c1-23(2,33(30,31)18-7-5-4-6-8-18)19-15-20(25-13-14-29)28-21(27-19)16-9-11-17(12-10-16)26-22(32)24-3/h4-12,15,29H,13-14H2,1-3H3,(H2,24,26,32)(H,25,27,28) |
| InChIKey | RLSRAXJCSRKSLX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|