C27H33ClO2 — CID 70308538
(E)-3-[4-(4-chlorophenyl)-2,5-dimethylphenyl]-4-hydroxy-4-(1,3,4-trimethylcyclohexyl)but-3-en-2-one (PubChem CID 70308538) has the molecular formula C27H33ClO2 and a molecular weight of 425.01 g/mol. Its IUPAC name is (E)-3-[4-(4-chlorophenyl)-2,5-dimethylphenyl]-4-hydroxy-4-(1,3,4-trimethylcyclohexyl)but-3-en-2-one.
| Compound Name | (E)-3-[4-(4-chlorophenyl)-2,5-dimethylphenyl]-4-hydroxy-4-(1,3,4-trimethylcyclohexyl)but-3-en-2-one |
|---|---|
| PubChem CID | 70308538 |
| Molecular Formula | C27H33ClO2 |
| Molecular Weight | 425.01 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (E)-3-[4-(4-chlorophenyl)-2,5-dimethylphenyl]-4-hydroxy-4-(1,3,4-trimethylcyclohexyl)but-3-en-2-one |
| SMILES | CC(=O)/C(=C(/O)C1(C)CCC(C)C(C)C1)c1cc(C)c(-c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C27H33ClO2/c1-16-11-12-27(6,15-19(16)4)26(30)25(20(5)29)24-14-17(2)23(13-18(24)3)21-7-9-22(28)10-8-21/h7-10,13-14,16,19,30H,11-12,15H2,1-6H3/b26-25- |
| InChIKey | SJRGVELQVKALMD-QPLCGJKRSA-N |
| XLogP | 7.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.01 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|