C9H17N3O3S — CID 70310087
5-oxo-N-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-sulfonamide (PubChem CID 70310087) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-oxo-N-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-sulfonamide.
| Compound Name | 5-oxo-N-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-sulfonamide |
|---|---|
| PubChem CID | 70310087 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-oxo-N-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-sulfonamide |
| SMILES | CCCNS(=O)(=O)N1C(=O)CC2NCCC21 |
| InChI | InChI=1S/C9H17N3O3S/c1-2-4-11-16(14,15)12-8-3-5-10-7(8)6-9(12)13/h7-8,10-11H,2-6H2,1H3 |
| InChIKey | FUNLDJGHLOISIN-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |