About (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine
(3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 70310852) has the molecular formula C7H9ClFN
and a molecular weight of 161.61 g/mol. Its IUPAC name is (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine |
| PubChem CID | 70310852 |
| Molecular Formula | C7H9ClFN |
| Molecular Weight | 161.61 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | NCC1=CC(Cl)=C(F)CC1 |
| InChI | InChI=1S/C7H9ClFN/c8-6-3-5(4-10)1-2-7(6)9/h3H,1-2,4,10H2 |
| InChIKey | MXKGWSCMPHTUNU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine?
The IUPAC name of (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine (CID 70310852) is (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine.
What is the SMILES notation for (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine?
The canonical SMILES for (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine is NCC1=CC(Cl)=C(F)CC1.
What is the InChIKey of (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine?
The InChIKey is MXKGWSCMPHTUNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClFN/c8-6-3-5(4-10)1-2-7(6)9/h3H,1-2,4,10H2.
What are the key properties of (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine?
(3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine has a molecular weight of 161.61 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-fluorocyclohexa-1,3-dien-1-yl)methanamine is sourced from PubChem (CID 70310852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).