About (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine
(6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine (PubChem CID 88561653) has the molecular formula C7H8FN
and a molecular weight of 125.15 g/mol. Its IUPAC name is (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine.
Analyze (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine?
The IUPAC name of (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine (CID 88561653) is (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine.
What is the SMILES notation for (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine?
The canonical SMILES for (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine is NCC1=CC=C=CC1F.
What is the InChIKey of (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine?
The InChIKey is DZHCOXVFUVOWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN/c8-7-4-2-1-3-6(7)5-9/h1,3-4,7H,5,9H2.
What are the key properties of (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine?
(6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine has a molecular weight of 125.15 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluorocyclohexa-1,3,4-trien-1-yl)methanamine is sourced from PubChem (CID 88561653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).