C37H41FN2O5 — CID 70312155
4-fluoro-2-hydroxy-N-[(3S)-3-methoxy-8-methyl-5-[(3-phenoxybenzoyl)amino]-1-phenylnonan-2-yl]benzamide (PubChem CID 70312155) has the molecular formula C37H41FN2O5 and a molecular weight of 612.74 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-[(3S)-3-methoxy-8-methyl-5-[(3-phenoxybenzoyl)amino]-1-phenylnonan-2-yl]benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-[(3S)-3-methoxy-8-methyl-5-[(3-phenoxybenzoyl)amino]-1-phenylnonan-2-yl]benzamide |
|---|---|
| PubChem CID | 70312155 |
| Molecular Formula | C37H41FN2O5 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-[(3S)-3-methoxy-8-methyl-5-[(3-phenoxybenzoyl)amino]-1-phenylnonan-2-yl]benzamide |
| SMILES | CO[C@@H](CC(CCC(C)C)NC(=O)c1cccc(Oc2ccccc2)c1)C(Cc1ccccc1)NC(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C37H41FN2O5/c1-25(2)17-19-29(39-36(42)27-13-10-16-31(22-27)45-30-14-8-5-9-15-30)24-35(44-3)33(21-26-11-6-4-7-12-26)40-37(43)32-20-18-28(38)23-34(32)41/h4-16,18,20,22-23,25,29,33,35,41H,17,19,21,24H2,1-3H3,(H,39,42)(H,40,43)/t29?,33?,35-/m0/s1 |
| InChIKey | QPFPRUYGEDAFKH-ISEJWESUSA-N |
| XLogP | 7.30 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |