C30H42FN3O5 — CID 70314696
N-[(3S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-hydroxy-8-methyl-1-phenylnonan-2-yl]-4-fluoro-2-hydroxybenzamide (PubChem CID 70314696) has the molecular formula C30H42FN3O5 and a molecular weight of 543.68 g/mol. Its IUPAC name is N-[(3S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-hydroxy-8-methyl-1-phenylnonan-2-yl]-4-fluoro-2-hydroxybenzamide.
| Compound Name | N-[(3S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-hydroxy-8-methyl-1-phenylnonan-2-yl]-4-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 70314696 |
| Molecular Formula | C30H42FN3O5 |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | N-[(3S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-hydroxy-8-methyl-1-phenylnonan-2-yl]-4-fluoro-2-hydroxybenzamide |
| SMILES | CC(=O)N[C@H](C(=O)NC(CCC(C)C)C[C@H](O)C(Cc1ccccc1)NC(=O)c1ccc(F)cc1O)C(C)C |
| InChI | InChI=1S/C30H42FN3O5/c1-18(2)11-13-23(33-30(39)28(19(3)4)32-20(5)35)17-27(37)25(15-21-9-7-6-8-10-21)34-29(38)24-14-12-22(31)16-26(24)36/h6-10,12,14,16,18-19,23,25,27-28,36-37H,11,13,15,17H2,1-5H3,(H,32,35)(H,33,39)(H,34,38)/t23?,25?,27-,28-/m0/s1 |
| InChIKey | WDIMEWXGTJPMGH-JZZCGGKKSA-N |
| XLogP | 3.71 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |