C13H17N3O2 — CID 7031403
2-(3-imidazol-1-ylpropyliminomethyl)cyclohexane-1,3-dione (PubChem CID 7031403) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(3-imidazol-1-ylpropyliminomethyl)cyclohexane-1,3-dione.
| Compound Name | 2-(3-imidazol-1-ylpropyliminomethyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7031403 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-(3-imidazol-1-ylpropyliminomethyl)cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1/C=N/CCCn1ccnc1 |
| InChI | InChI=1S/C13H17N3O2/c17-12-3-1-4-13(18)11(12)9-14-5-2-7-16-8-6-15-10-16/h6,8-11H,1-5,7H2/b14-9+ |
| InChIKey | WNFYSDJLGZLOSH-NTEUORMPSA-N |
| XLogP | 1.28 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|