C19H25N5O3 — CID 7309641
1-[2-(cyclohexen-1-yl)ethyl]-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7309641) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7309641 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-5-(3-imidazol-1-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(CCC2=CCCCC2)C(=O)C1/C=N/CCCn1ccnc1 |
| InChI | InChI=1S/C19H25N5O3/c25-17-16(13-20-8-4-10-23-12-9-21-14-23)18(26)24(19(27)22-17)11-7-15-5-2-1-3-6-15/h5,9,12-14,16H,1-4,6-8,10-11H2,(H,22,25,27)/b20-13+ |
| InChIKey | SGUAUGWYPOKIBL-DEDYPNTBSA-N |
| XLogP | 1.93 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|