C26H37FN6O2 — CID 70318290
N-[2-(cyclohexylmethylamino)-6-(6-fluoro-3-pyridinyl)-3-pyridinyl]-2-methoxy-N'-(2-morpholin-4-ylethyl)ethanimidamide (PubChem CID 70318290) has the molecular formula C26H37FN6O2 and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[2-(cyclohexylmethylamino)-6-(6-fluoro-3-pyridinyl)-3-pyridinyl]-2-methoxy-N'-(2-morpholin-4-ylethyl)ethanimidamide.
| Compound Name | N-[2-(cyclohexylmethylamino)-6-(6-fluoro-3-pyridinyl)-3-pyridinyl]-2-methoxy-N'-(2-morpholin-4-ylethyl)ethanimidamide |
|---|---|
| PubChem CID | 70318290 |
| Molecular Formula | C26H37FN6O2 |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | N-[2-(cyclohexylmethylamino)-6-(6-fluoro-3-pyridinyl)-3-pyridinyl]-2-methoxy-N'-(2-morpholin-4-ylethyl)ethanimidamide |
| SMILES | COC/C(=N\CCN1CCOCC1)Nc1ccc(-c2ccc(F)nc2)nc1NCC1CCCCC1 |
| InChI | InChI=1S/C26H37FN6O2/c1-34-19-25(28-11-12-33-13-15-35-16-14-33)31-23-9-8-22(21-7-10-24(27)29-18-21)32-26(23)30-17-20-5-3-2-4-6-20/h7-10,18,20H,2-6,11-17,19H2,1H3,(H,28,31)(H,30,32) |
| InChIKey | NRJPRFBWOYWCIU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|