C28H50N6O7S — CID 70318942
(4R,14S)-14-[[1-[dimethylsulfamoyl(methyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid (PubChem CID 70318942) has the molecular formula C28H50N6O7S and a molecular weight of 614.81 g/mol. Its IUPAC name is (4R,14S)-14-[[1-[dimethylsulfamoyl(methyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid.
| Compound Name | (4R,14S)-14-[[1-[dimethylsulfamoyl(methyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid |
|---|---|
| PubChem CID | 70318942 |
| Molecular Formula | C28H50N6O7S |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | (4R,14S)-14-[[1-[dimethylsulfamoyl(methyl)amino]-3,3-dimethylbutan-2-yl]carbamoylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)N(C)CC(NC(=O)N[C@H]1CCCCCCCC2C[C@@]2(C(=O)O)NC(=O)C2CCCN2C1=O)C(C)(C)C |
| InChI | InChI=1S/C28H50N6O7S/c1-27(2,3)22(18-33(6)42(40,41)32(4)5)30-26(39)29-20-14-11-9-7-8-10-13-19-17-28(19,25(37)38)31-23(35)21-15-12-16-34(21)24(20)36/h19-22H,7-18H2,1-6H3,(H,31,35)(H,37,38)(H2,29,30,39)/t19?,20-,21?,22?,28+/m0/s1 |
| InChIKey | NRGDPNMUPGMVMI-PDCKYLNCSA-N |
| XLogP | 1.50 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |